7g6d
From Proteopedia
Crystal Structure of rat Autotaxin in complex with 10-[[3-(trifluoromethoxy)phenyl]methyl]-1,3,4,5-tetrahydroazepino[3,4-b]indole-2-carboxamide, i.e. SMILES N1(c2c(cccc2)C2=C1CN(CCC2)C(=O)N)Cc1cccc(c1)OC(F)(F)F with IC50=0.35326 microM
| |||||||||||
