7fwy
From Proteopedia
Crystal Structure of human FABP4 in complex with 2-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)sulfanyl]acetic acid, i.e. SMILES c12c(Sc3c(C[C@H]1SCC(=O)O)cc(cc3)Cl)cccc2 with IC50=1.7 microM
| |||||||||||
Categories: Homo sapiens | Large Structures | Benz J | Boehringer M | Ehler A | Obst U | Rudolph MG
