7fyf
From Proteopedia
Crystal Structure of human FABP4 in complex with 4-(4-fluorophenyl)-2-piperidin-1-yl-3-(1H-tetrazol-5-yl)-7,8-dihydro-5H-pyrano[4,3-b]pyridine, i.e. SMILES c1(ccc(cc1)F)c1c(c(N2CCCCC2)nc2c1COCC2)C1=NN=NN1 with IC50=0.42193 microM
| |||||||||||
Categories: Homo sapiens | Large Structures | Benz J | Ehler A | Obst U | Obst-Sander U | Rudolph MG
