7fzl
From Proteopedia
Crystal Structure of human FABP4 in complex with 3-(3-chlorophenyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione, i.e. SMILES N1(C(=NNC1=S)c1cc(Cl)ccc1)CC=C with IC50=1.4 microM
| |||||||||||
Categories: Homo sapiens | Large Structures | Benz J | Brunner M | Ehler A | Obst U | Rudolph MG
