7g0f
From Proteopedia
Crystal Structure of human FABP4 in complex with 6-[(3-methoxycarbonyl-4-thiophen-2-ylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid, i.e. SMILES C1(=C(NC(=O)[C@H]2[C@@H](C(=O)O)CC=CC2)SC=C1C1=CC=CS1)C(=O)OC with IC50=1.1 microM
| |||||||||||
Categories: Homo sapiens | Large Structures | Benz J | Brunner M | Ehler A | Obst U | Rudolph MG
