7g0t
From Proteopedia
Crystal Structure of human FABP4 in complex with 1-[[4-chloro-2-(trifluoromethyl)phenyl]carbamoylamino]cyclopentane-1-carboxylic acid, i.e. SMILES C1(NC(=O)Nc2c(cc(cc2)Cl)C(F)(F)F)(CCCC1)C(=O)O with IC50=2.54561 microM
| |||||||||||
Categories: Homo sapiens | Large Structures | Benz J | Ehler A | Maurer M | Obst U | Rudolph MG
